C22H30O4 — CID 69134002
methyl (2Z)-2-[(8R,9R,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-6-ylidene]acetate (PubChem CID 69134002) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl (2Z)-2-[(8R,9R,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-6-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(8R,9R,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-6-ylidene]acetate |
|---|---|
| PubChem CID | 69134002 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl (2Z)-2-[(8R,9R,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-6-ylidene]acetate |
| SMILES | COC(=O)/C=C1/C[C@@H]2[C@@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)CCC(=O)CC12 |
| InChI | InChI=1S/C22H30O4/c1-21-8-6-14(23)12-18(21)13(11-20(25)26-3)10-15-16-4-5-19(24)22(16,2)9-7-17(15)21/h11,15-18H,4-10,12H2,1-3H3/b13-11-/t15-,16-,17+,18?,21+,22-/m0/s1 |
| InChIKey | YKWLVUMMVVPLMQ-PWRNYMKSSA-N |
| XLogP | 3.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|