C18H27NO2 — CID 90996433
(3R,8R,9S,10R,13S,14S)-17-amino-3-hydroxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-one (PubChem CID 90996433) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S)-17-amino-3-hydroxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-one.
| Compound Name | (3R,8R,9S,10R,13S,14S)-17-amino-3-hydroxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 90996433 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S)-17-amino-3-hydroxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@H](O)CC[C@@H]43)[C@@H]1CC(=O)C2N |
| InChI | InChI=1S/C18H27NO2/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(21)17(18)19/h2,11-15,17,20H,3-9,19H2,1H3/t11-,12+,13-,14-,15+,17?,18+/m1/s1 |
| InChIKey | XASJFVLEMFEDFM-QMRYALLESA-N |
| XLogP | 2.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|