C27H38O3S — CID 142332880
17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 142332880) has the molecular formula C27H38O3S and a molecular weight of 442.67 g/mol. Its IUPAC name is 17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142332880 |
| Molecular Formula | C27H38O3S |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)C1CCC2C3CC=C4CC(O)CCC4C3CCC21C |
| InChI | InChI=1S/C27H38O3S/c1-18(17-31(29,30)21-6-4-3-5-7-21)25-12-13-26-24-10-8-19-16-20(28)9-11-22(19)23(24)14-15-27(25,26)2/h3-8,18,20,22-26,28H,9-17H2,1-2H3/t18-,20?,22?,23?,24?,25?,26?,27?/m1/s1 |
| InChIKey | YQPAXCUPQOGERR-WBCZXSKZSA-N |
| XLogP | 5.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|