C33H50O3S — CID 4007164
[13-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate (PubChem CID 4007164) has the molecular formula C33H50O3S and a molecular weight of 526.83 g/mol. Its IUPAC name is [13-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [13-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 4007164 |
| Molecular Formula | C33H50O3S |
| Molecular Weight | 526.83 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | [13-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3C(=CCC4C3CCC3(C)C(C(C)CCCC(C)C)CCC43)C2)cc1 |
| InChI | InChI=1S/C33H50O3S/c1-22(2)7-6-8-24(4)31-17-18-32-30-15-11-25-21-26(12-16-28(25)29(30)19-20-33(31,32)5)36-37(34,35)27-13-9-23(3)10-14-27/h9-11,13-14,22,24,26,28-32H,6-8,12,15-21H2,1-5H3 |
| InChIKey | WLXZYBUVBHLRRX-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.83 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|