C33H50O3S — CID 11533804
[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzenesulfonate (PubChem CID 11533804) has the molecular formula C33H50O3S and a molecular weight of 526.83 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzenesulfonate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzenesulfonate |
|---|---|
| PubChem CID | 11533804 |
| Molecular Formula | C33H50O3S |
| Molecular Weight | 526.83 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzenesulfonate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OS(=O)(=O)c5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H50O3S/c1-23(2)10-9-11-24(3)29-16-17-30-28-15-14-25-22-26(36-37(34,35)27-12-7-6-8-13-27)18-20-32(25,4)31(28)19-21-33(29,30)5/h6-8,12-14,23-24,26,28-31H,9-11,15-22H2,1-5H3/t24-,26+,28+,29-,30+,31+,32+,33-/m1/s1 |
| InChIKey | GMPZJKJAVQVEIL-DMQOEKFGSA-N |
| XLogP | 8.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.83 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|