C36H56O4S — CID 170252562
(3S)-17-[(2R)-4-(benzenesulfonyl)-6-hydroxy-7,7-dimethyloctan-2-yl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 170252562) has the molecular formula C36H56O4S and a molecular weight of 584.91 g/mol. Its IUPAC name is (3S)-17-[(2R)-4-(benzenesulfonyl)-6-hydroxy-7,7-dimethyloctan-2-yl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S)-17-[(2R)-4-(benzenesulfonyl)-6-hydroxy-7,7-dimethyloctan-2-yl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 170252562 |
| Molecular Formula | C36H56O4S |
| Molecular Weight | 584.91 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | (3S)-17-[(2R)-4-(benzenesulfonyl)-6-hydroxy-7,7-dimethyloctan-2-yl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CCC2C(=CCC3C2CCC2(C)C3CCC2[C@H](C)CC(CC(O)C(C)(C)C)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C36H56O4S/c1-7-36(38)20-18-28-25(23-36)13-14-30-29(28)17-19-35(6)31(15-16-32(30)35)24(2)21-27(22-33(37)34(3,4)5)41(39,40)26-11-9-8-10-12-26/h8-13,24,27-33,37-38H,7,14-23H2,1-6H3/t24-,27?,28?,29?,30?,31?,32?,33?,35?,36+/m1/s1 |
| InChIKey | NNXKIXXLPXWTNN-XTJDWMMKSA-N |
| XLogP | 7.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.91 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|