C33H50O4S — CID 134452009
(3S,8R,9S,10R,13R,14S,17R)-17-[(2R,6R)-4-(benzenesulfonyl)-6-hydroxyheptan-2-yl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 134452009) has the molecular formula C33H50O4S and a molecular weight of 542.83 g/mol. Its IUPAC name is (3S,8R,9S,10R,13R,14S,17R)-17-[(2R,6R)-4-(benzenesulfonyl)-6-hydroxyheptan-2-yl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13R,14S,17R)-17-[(2R,6R)-4-(benzenesulfonyl)-6-hydroxyheptan-2-yl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134452009 |
| Molecular Formula | C33H50O4S |
| Molecular Weight | 542.83 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | (3S,8R,9S,10R,13R,14S,17R)-17-[(2R,6R)-4-(benzenesulfonyl)-6-hydroxyheptan-2-yl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@H]2C(=CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CC(C[C@@H](C)O)S(=O)(=O)c4ccccc4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C33H50O4S/c1-5-33(35)18-16-27-24(21-33)11-12-29-28(27)15-17-32(4)30(13-14-31(29)32)22(2)19-26(20-23(3)34)38(36,37)25-9-7-6-8-10-25/h6-11,22-23,26-31,34-35H,5,12-21H2,1-4H3/t22-,23-,26?,27+,28-,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | PEOSSWNSKKUEHX-XSQDCDQJSA-N |
| XLogP | 6.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.83 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|