C23H36F2O — CID 118133546
(3S,10R,13S,17R)-17-(3,3-difluoropentan-2-yl)-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 118133546) has the molecular formula C23H36F2O and a molecular weight of 366.54 g/mol. Its IUPAC name is (3S,10R,13S,17R)-17-(3,3-difluoropentan-2-yl)-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13S,17R)-17-(3,3-difluoropentan-2-yl)-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118133546 |
| Molecular Formula | C23H36F2O |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | (3S,10R,13S,17R)-17-(3,3-difluoropentan-2-yl)-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(F)(F)C(C)[C@H]1CCC2C3CC=C4C[C@@H](O)CC[C@@H]4C3CC[C@@]21C |
| InChI | InChI=1S/C23H36F2O/c1-4-23(24,25)14(2)20-9-10-21-19-7-5-15-13-16(26)6-8-17(15)18(19)11-12-22(20,21)3/h5,14,16-21,26H,4,6-13H2,1-3H3/t14?,16-,17-,18?,19?,20+,21?,22+/m0/s1 |
| InChIKey | JWOWHQRQBSURBL-LLMQOSELSA-N |
| XLogP | 6.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|