C19H27NO3 — CID 143192991
[(8R,13S)-13-methyl-17-oxo-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbamate (PubChem CID 143192991) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is [(8R,13S)-13-methyl-17-oxo-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbamate.
| Compound Name | [(8R,13S)-13-methyl-17-oxo-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbamate |
|---|---|
| PubChem CID | 143192991 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [(8R,13S)-13-methyl-17-oxo-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbamate |
| SMILES | C[C@]12CCC3C4CCC(OC(N)=O)CC4=CC[C@H]3C1CCC2=O |
| InChI | InChI=1S/C19H27NO3/c1-19-9-8-14-13-5-3-12(23-18(20)22)10-11(13)2-4-15(14)16(19)6-7-17(19)21/h2,12-16H,3-10H2,1H3,(H2,20,22)/t12?,13?,14?,15-,16?,19+/m1/s1 |
| InChIKey | AYZCCHNEEIACPB-KFVFEMPRSA-N |
| XLogP | 3.59 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|