C23H34N2O4 — CID 54227386
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] (2S)-2,4-diamino-4-oxobutanoate (PubChem CID 54227386) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] (2S)-2,4-diamino-4-oxobutanoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] (2S)-2,4-diamino-4-oxobutanoate |
|---|---|
| PubChem CID | 54227386 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] (2S)-2,4-diamino-4-oxobutanoate |
| SMILES | C[C@]12CC[C@H](OC(=O)[C@@H](N)CC(N)=O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H34N2O4/c1-22-9-7-14(29-21(28)18(24)12-20(25)27)11-13(22)3-4-15-16-5-6-19(26)23(16,2)10-8-17(15)22/h3,14-18H,4-12,24H2,1-2H3,(H2,25,27)/t14-,15-,16-,17-,18-,22-,23-/m0/s1 |
| InChIKey | QGUYUPAHEDCWHE-DGUGNSGZSA-N |
| XLogP | 2.63 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|