C28H44O8 — CID 162946258
[17-(1-acetyloxyethyl)-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 2-methylbutanoate (PubChem CID 162946258) has the molecular formula C28H44O8 and a molecular weight of 508.65 g/mol. Its IUPAC name is [17-(1-acetyloxyethyl)-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 2-methylbutanoate.
| Compound Name | [17-(1-acetyloxyethyl)-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 162946258 |
| Molecular Formula | C28H44O8 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | [17-(1-acetyloxyethyl)-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC2C3(C)CCC(O)CC3=CCC2(O)C2(O)CCC(O)(C(C)OC(C)=O)C12C |
| InChI | InChI=1S/C28H44O8/c1-7-16(2)23(31)36-22-15-21-24(5)10-9-20(30)14-19(24)8-11-27(21,33)28(34)13-12-26(32,25(22,28)6)17(3)35-18(4)29/h8,16-17,20-22,30,32-34H,7,9-15H2,1-6H3 |
| InChIKey | QJVOCQAZQZVJPM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|