C28H42O7 — CID 162851668
[(3S,8R,9R,10R,12R,13S,14S,17S)-17-[(1S)-1-acetyloxyethyl]-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate (PubChem CID 162851668) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is [(3S,8R,9R,10R,12R,13S,14S,17S)-17-[(1S)-1-acetyloxyethyl]-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(3S,8R,9R,10R,12R,13S,14S,17S)-17-[(1S)-1-acetyloxyethyl]-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162851668 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | [(3S,8R,9R,10R,12R,13S,14S,17S)-17-[(1S)-1-acetyloxyethyl]-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1C[C@@H]2[C@@H](CC=C3C[C@@H](O)CC[C@@]32C)[C@@]2(O)CC[C@@](O)([C@H](C)OC(C)=O)[C@@]12C |
| InChI | InChI=1S/C28H42O7/c1-7-16(2)24(31)35-23-15-22-21(9-8-19-14-20(30)10-11-25(19,22)5)28(33)13-12-27(32,26(23,28)6)17(3)34-18(4)29/h7-8,17,20-23,30,32-33H,9-15H2,1-6H3/b16-7+/t17-,20-,21+,22+,23+,25-,26+,27+,28-/m0/s1 |
| InChIKey | SNODXXCIXZZWAD-TVKDTUDRSA-N |
| XLogP | 3.60 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|