C30H50O4 — CID 162939594
[(3S,8R,9S,10R,12R,13R,14S,17R)-3-hydroxy-17-[(2R,4R,5S)-4-hydroxy-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate (PubChem CID 162939594) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is [(3S,8R,9S,10R,12R,13R,14S,17R)-3-hydroxy-17-[(2R,4R,5S)-4-hydroxy-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,12R,13R,14S,17R)-3-hydroxy-17-[(2R,4R,5S)-4-hydroxy-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate |
|---|---|
| PubChem CID | 162939594 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | [(3S,8R,9S,10R,12R,13R,14S,17R)-3-hydroxy-17-[(2R,4R,5S)-4-hydroxy-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2[C@@H](CC=C3C[C@@H](O)CC[C@@]32C)[C@@H]2CC[C@H]([C@H](C)C[C@@H](O)[C@@H](C)C(C)C)[C@@]12C |
| InChI | InChI=1S/C30H50O4/c1-17(2)19(4)27(33)14-18(3)24-10-11-25-23-9-8-21-15-22(32)12-13-29(21,6)26(23)16-28(30(24,25)7)34-20(5)31/h8,17-19,22-28,32-33H,9-16H2,1-7H3/t18-,19+,22+,23+,24-,25+,26+,27-,28-,29+,30-/m1/s1 |
| InChIKey | FWOFLAFLCPNJMF-PZRYGWEBSA-N |
| XLogP | 6.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|