C25H38O6 — CID 23264008
[3,17-dihydroxy-17-(3-methoxypropanoyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 23264008) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is [3,17-dihydroxy-17-(3-methoxypropanoyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [3,17-dihydroxy-17-(3-methoxypropanoyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 23264008 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [3,17-dihydroxy-17-(3-methoxypropanoyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | COCCC(=O)C1(O)C(OC(C)=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C25H38O6/c1-15(26)31-22-14-20-18-6-5-16-13-17(27)7-10-23(16,2)19(18)8-11-24(20,3)25(22,29)21(28)9-12-30-4/h5,17-20,22,27,29H,6-14H2,1-4H3 |
| InChIKey | DBGYXWZARNUJAE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|