C23H32BrFO4 — CID 88815795
[(8R,9S,10R,13S,14S,17R)-16-bromo-17-(2-fluoroacetyl)-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 88815795) has the molecular formula C23H32BrFO4 and a molecular weight of 471.41 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-16-bromo-17-(2-fluoroacetyl)-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-16-bromo-17-(2-fluoroacetyl)-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 88815795 |
| Molecular Formula | C23H32BrFO4 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-16-bromo-17-(2-fluoroacetyl)-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CC(Br)[C@]2(O)C(=O)CF)C1 |
| InChI | InChI=1S/C23H32BrFO4/c1-13(26)29-15-6-8-21(2)14(10-15)4-5-16-17(21)7-9-22(3)18(16)11-19(24)23(22,28)20(27)12-25/h4,15-19,28H,5-12H2,1-3H3/t15?,16-,17+,18+,19?,21+,22+,23+/m1/s1 |
| InChIKey | HHPFEPGEBSLREV-FCZSEEJRSA-N |
| XLogP | 4.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|