C22H30BrIO4 — CID 154361690
[(3S,8R,9S,10R,13S,14S,16S,17R)-16-bromo-17-hydroxy-17-(2-iodoacetyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] formate (PubChem CID 154361690) has the molecular formula C22H30BrIO4 and a molecular weight of 565.29 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,16S,17R)-16-bromo-17-hydroxy-17-(2-iodoacetyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,16S,17R)-16-bromo-17-hydroxy-17-(2-iodoacetyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 154361690 |
| Molecular Formula | C22H30BrIO4 |
| Molecular Weight | 565.29 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,16S,17R)-16-bromo-17-hydroxy-17-(2-iodoacetyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] formate |
| SMILES | C[C@]12CC[C@H](OC=O)CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1C[C@H](Br)[C@]2(O)C(=O)CI |
| InChI | InChI=1S/C22H30BrIO4/c1-20-7-5-14(28-12-25)9-13(20)3-4-15-16(20)6-8-21(2)17(15)10-18(23)22(21,27)19(26)11-24/h3,12,14-18,27H,4-11H2,1-2H3/t14-,15+,16-,17-,18-,20-,21-,22-/m0/s1 |
| InChIKey | CGQZACCGQQXSDT-BCJMKXOLSA-N |
| XLogP | 4.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|