C20H28O2 — CID 141473082
[(3S,8S,9S,10R,13R,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] formate (PubChem CID 141473082) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [(3S,8S,9S,10R,13R,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 141473082 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
| SMILES | C[C@@]12C=CC[C@H]1[C@@H]1CC=C3C[C@@H](OC=O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H28O2/c1-19-9-3-4-17(19)16-6-5-14-12-15(22-13-21)7-11-20(14,2)18(16)8-10-19/h3,5,9,13,15-18H,4,6-8,10-12H2,1-2H3/t15-,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | OPQXECOGJAEMCA-RABCQHRBSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|