C23H36O3 — CID 46837327
[(1S,2R,5S,11S,12S,15S,16S)-15-[(1R)-1-hydroxyethyl]-2,16-dimethyl-5-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl] formate (PubChem CID 46837327) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is [(1S,2R,5S,11S,12S,15S,16S)-15-[(1R)-1-hydroxyethyl]-2,16-dimethyl-5-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl] formate.
| Compound Name | [(1S,2R,5S,11S,12S,15S,16S)-15-[(1R)-1-hydroxyethyl]-2,16-dimethyl-5-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl] formate |
|---|---|
| PubChem CID | 46837327 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | [(1S,2R,5S,11S,12S,15S,16S)-15-[(1R)-1-hydroxyethyl]-2,16-dimethyl-5-tetracyclo[9.7.0.02,8.012,16]octadec-8-enyl] formate |
| SMILES | C[C@@H](O)[C@H]1CC[C@H]2[C@@H]3CC=C4CC[C@H](OC=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H36O3/c1-15(25)19-8-9-20-18-7-5-16-4-6-17(26-14-24)10-12-22(16,2)21(18)11-13-23(19,20)3/h5,14-15,17-21,25H,4,6-13H2,1-3H3/t15-,17+,18+,19-,20+,21+,22+,23-/m1/s1 |
| InChIKey | NCAZJYDJCYPXRF-YDDBCJSBSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|