C21H34NaO5S — CID 131872039
CID 131872039 (PubChem CID 131872039) has the molecular formula C21H34NaO5S and a molecular weight of 421.56 g/mol.
| Compound Name | CID 131872039 |
|---|---|
| PubChem CID | 131872039 |
| Molecular Formula | C21H34NaO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | — |
| SMILES | CC(O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OS(=O)(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C.[Na] |
| InChI | InChI=1S/C21H34O5S.Na/c1-13(22)17-6-7-18-16-5-4-14-12-15(26-27(23,24)25)8-10-20(14,2)19(16)9-11-21(17,18)3;/h4,13,15-19,22H,5-12H2,1-3H3,(H,23,24,25);/t13?,15-,16-,17+,18-,19-,20-,21+;/m0./s1 |
| InChIKey | AGTXSWRQRTZXAJ-UKGYISDKSA-N |
| XLogP | 3.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|