C20H30O6S — CID 3789828
10,13-dimethyl-3-sulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 3789828) has the molecular formula C20H30O6S and a molecular weight of 398.52 g/mol. Its IUPAC name is 10,13-dimethyl-3-sulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | 10,13-dimethyl-3-sulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 3789828 |
| Molecular Formula | C20H30O6S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 10,13-dimethyl-3-sulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CC12CCC(OS(=O)(=O)O)CC1=CCC1C2CCC2(C)C(C(=O)O)CCC12 |
| InChI | InChI=1S/C20H30O6S/c1-19-9-7-13(26-27(23,24)25)11-12(19)3-4-14-15-5-6-17(18(21)22)20(15,2)10-8-16(14)19/h3,13-17H,4-11H2,1-2H3,(H,21,22)(H,23,24,25) |
| InChIKey | VEPHSKOXIHKFBU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|