C21H30O9S2-2 — CID 122198217
[(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-sulfonatooxyacetyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate (PubChem CID 122198217) has the molecular formula C21H30O9S2-2 and a molecular weight of 490.60 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-sulfonatooxyacetyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-sulfonatooxyacetyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate |
|---|---|
| PubChem CID | 122198217 |
| Molecular Formula | C21H30O9S2-2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-sulfonatooxyacetyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](OS(=O)(=O)[O-])CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)COS(=O)(=O)[O-] |
| InChI | InChI=1S/C21H32O9S2/c1-20-9-7-14(30-32(26,27)28)11-13(20)3-4-15-16-5-6-18(19(22)12-29-31(23,24)25)21(16,2)10-8-17(15)20/h3,14-18H,4-12H2,1-2H3,(H,23,24,25)(H,26,27,28)/p-2/t14-,15-,16-,17-,18+,20-,21-/m0/s1 |
| InChIKey | CBOVWLYQUCVTFA-WPWXJNKXSA-L |
| XLogP | 2.46 |
| TPSA | 149.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|