C21H32O6S — CID 514133
[(3S)-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 514133) has the molecular formula C21H32O6S and a molecular weight of 412.55 g/mol. Its IUPAC name is [(3S)-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(3S)-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 514133 |
| Molecular Formula | C21H32O6S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [(3S)-17-(2-hydroxyacetyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | CC12CC[C@H](OS(=O)(=O)O)CC1=CCC1C2CCC2(C)C(C(=O)CO)CCC12 |
| InChI | InChI=1S/C21H32O6S/c1-20-9-7-14(27-28(24,25)26)11-13(20)3-4-15-16-5-6-18(19(23)12-22)21(16,2)10-8-17(15)20/h3,14-18,22H,4-12H2,1-2H3,(H,24,25,26)/t14-,15?,16?,17?,18?,20?,21?/m0/s1 |
| InChIKey | DFSPOIZXVIWHFO-HFMUPVQQSA-N |
| XLogP | 3.31 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|