C30H44O6 — CID 166941782
ethyl (E,4R)-4-[(3S,8R,9S,10R,12R,13R,14S)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate (PubChem CID 166941782) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(3S,8R,9S,10R,12R,13R,14S)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(3S,8R,9S,10R,12R,13R,14S)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate |
|---|---|
| PubChem CID | 166941782 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | ethyl (E,4R)-4-[(3S,8R,9S,10R,12R,13R,14S)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)C1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3C[C@@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C30H44O6/c1-7-34-28(33)13-8-18(2)24-11-12-25-23-10-9-21-16-22(35-19(3)31)14-15-29(21,5)26(23)17-27(30(24,25)6)36-20(4)32/h8-9,13,18,22-27H,7,10-12,14-17H2,1-6H3/b13-8+/t18-,22+,23+,24?,25+,26+,27-,29+,30-/m1/s1 |
| InChIKey | VYOYGTPCCNIBBE-SUWHOSFFSA-N |
| XLogP | 5.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|