C29H42O4 — CID 159299652
ethyl (E,4R)-4-[(3S,8R,9S,10R,12R,13S,14S)-12-acetyloxy-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate (PubChem CID 159299652) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(3S,8R,9S,10R,12R,13S,14S)-12-acetyloxy-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(3S,8R,9S,10R,12R,13S,14S)-12-acetyloxy-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate |
|---|---|
| PubChem CID | 159299652 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | ethyl (E,4R)-4-[(3S,8R,9S,10R,12R,13S,14S)-12-acetyloxy-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)C1=CC[C@H]2[C@@H]3CC=C4C[C@@H](C)CC[C@]4(C)[C@H]3C[C@@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C29H42O4/c1-7-32-27(31)13-8-19(3)23-11-12-24-22-10-9-21-16-18(2)14-15-28(21,5)25(22)17-26(29(23,24)6)33-20(4)30/h8-9,11,13,18-19,22,24-26H,7,10,12,14-17H2,1-6H3/b13-8+/t18-,19+,22-,24-,25-,26+,28-,29+/m0/s1 |
| InChIKey | XRZHBHZAPHNPEN-KCHBCONGSA-N |
| XLogP | 6.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|