C26H38O2 — CID 118082176
methyl (E,4R)-4-[(3R,5R,10S,13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate (PubChem CID 118082176) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is methyl (E,4R)-4-[(3R,5R,10S,13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate.
| Compound Name | methyl (E,4R)-4-[(3R,5R,10S,13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate |
|---|---|
| PubChem CID | 118082176 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | methyl (E,4R)-4-[(3R,5R,10S,13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](C)C1=CCC2C3CC[C@@H]4C[C@H](C)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C26H38O2/c1-17-12-14-25(3)19(16-17)7-8-20-22-10-9-21(18(2)6-11-24(27)28-5)26(22,4)15-13-23(20)25/h6,9,11,13,17-20,22H,7-8,10,12,14-16H2,1-5H3/b11-6+/t17-,18-,19-,20?,22?,25+,26-/m1/s1 |
| InChIKey | OKJHBCGQQGFZQY-ZYVZEKLUSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|