C25H36O3 — CID 123428611
methyl 4-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]but-2-enoate (PubChem CID 123428611) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is methyl 4-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]but-2-enoate.
| Compound Name | methyl 4-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]but-2-enoate |
|---|---|
| PubChem CID | 123428611 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | methyl 4-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]but-2-enoate |
| SMILES | COC(=O)C=CCC1=CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H36O3/c1-23(27)14-15-25(3)18(16-23)8-10-19-20-11-9-17(6-5-7-22(26)28-4)24(20,2)13-12-21(19)25/h5,7-9,19-21,27H,6,10-16H2,1-4H3/t19-,20-,21-,23-,24+,25-/m0/s1 |
| InChIKey | VZNOKIXJMUGNIO-ASQOANPZSA-N |
| XLogP | 5.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|