C22H33NO — CID 157053983
N-[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]acetamide (PubChem CID 157053983) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is N-[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]acetamide.
| Compound Name | N-[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]acetamide |
|---|---|
| PubChem CID | 157053983 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | N-[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]acetamide |
| SMILES | CC(=O)NC1=CCC2C3CC=C4C[C@@H](C)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C22H33NO/c1-14-9-11-21(3)16(13-14)5-6-17-18-7-8-20(23-15(2)24)22(18,4)12-10-19(17)21/h5,8,14,17-19H,6-7,9-13H2,1-4H3,(H,23,24)/t14-,17?,18?,19?,21-,22-/m0/s1 |
| InChIKey | XUBZXFAWZSFAFA-XXFDBAHHSA-N |
| XLogP | 5.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|