C26H39NO3 — CID 118691065
[(3S,8R,9S,10R,13S,14S)-17-acetamido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dimethylpropanoate (PubChem CID 118691065) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-17-acetamido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-17-acetamido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118691065 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-17-acetamido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)NC1=CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H39NO3/c1-16(28)27-22-10-9-20-19-8-7-17-15-18(30-23(29)24(2,3)4)11-13-25(17,5)21(19)12-14-26(20,22)6/h7,10,18-21H,8-9,11-15H2,1-6H3,(H,27,28)/t18-,19-,20-,21-,25-,26-/m0/s1 |
| InChIKey | AQUFQIJMGJXQPP-PAASFTFBSA-N |
| XLogP | 5.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|