C23H32N2O2 — CID 154372749
N-[(8R,9S,10R,13S,14S)-17-acetamido-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-3-yl]acetamide (PubChem CID 154372749) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[(8R,9S,10R,13S,14S)-17-acetamido-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-3-yl]acetamide.
| Compound Name | N-[(8R,9S,10R,13S,14S)-17-acetamido-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-3-yl]acetamide |
|---|---|
| PubChem CID | 154372749 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | N-[(8R,9S,10R,13S,14S)-17-acetamido-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-3-yl]acetamide |
| SMILES | CC(=O)NC1=CC[C@H]2[C@@H]3CC=C4CC(NC(C)=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H32N2O2/c1-14(26)24-17-9-11-22(3)16(13-17)5-6-18-19-7-8-21(25-15(2)27)23(19,4)12-10-20(18)22/h5,8-9,11,17-20H,6-7,10,12-13H2,1-4H3,(H,24,26)(H,25,27)/t17?,18-,19-,20-,22-,23-/m0/s1 |
| InChIKey | QLZGIMVDOHMWOU-OPSVTXQQSA-N |
| XLogP | 3.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|