C19H26O2 — CID 66709180
(8R,9R,10R,13S,14S)-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 66709180) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 66709180 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C=CC(O)CC1=CC[C@@H]1[C@H]2CC[C@]2(C)C(O)=CC[C@@H]12 |
| InChI | InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,6-7,9,13-16,20-21H,4-5,8,10-11H2,1-2H3/t13?,14-,15-,16+,18-,19-/m0/s1 |
| InChIKey | GPUWQHQDFUEDGI-PRCNVORZSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|