C23H31O3P — CID 176764055
(2R)-2-[(3R,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl]-2-(phosphanylidynemethoxy)propanal (PubChem CID 176764055) has the molecular formula C23H31O3P and a molecular weight of 386.47 g/mol. Its IUPAC name is (2R)-2-[(3R,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl]-2-(phosphanylidynemethoxy)propanal.
| Compound Name | (2R)-2-[(3R,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl]-2-(phosphanylidynemethoxy)propanal |
|---|---|
| PubChem CID | 176764055 |
| Molecular Formula | C23H31O3P |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2R)-2-[(3R,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl]-2-(phosphanylidynemethoxy)propanal |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)C=C[C@@]43C)[C@@H]1CC[C@@H]2[C@](C)(C=O)OC#P |
| InChI | InChI=1S/C23H31O3P/c1-21-10-8-16(25)12-15(21)4-5-17-18-6-7-20(23(3,13-24)26-14-27)22(18,2)11-9-19(17)21/h4,8,10,13,16-20,25H,5-7,9,11-12H2,1-3H3/t16-,17-,18-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | HNUQHNBZYCXIGU-FTQGCKHGSA-N |
| XLogP | 5.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|