C27H44O2S2 — CID 14702627
[(3S,8S,9S,10R,13S,14S,17S)-17-[1,1-bis(ethylsulfanyl)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 14702627) has the molecular formula C27H44O2S2 and a molecular weight of 464.78 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,17S)-17-[1,1-bis(ethylsulfanyl)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[1,1-bis(ethylsulfanyl)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 14702627 |
| Molecular Formula | C27H44O2S2 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[1,1-bis(ethylsulfanyl)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCSC(C)(SCC)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O2S2/c1-7-30-27(6,31-8-2)24-12-11-22-21-10-9-19-17-20(29-18(3)28)13-15-25(19,4)23(21)14-16-26(22,24)5/h9,20-24H,7-8,10-17H2,1-6H3/t20-,21-,22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | KXCVRKMELXISFL-OLDNPOFQSA-N |
| XLogP | 7.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|