C27H41NO4 — CID 4836173
[17-[1-hydroxy-1-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 4836173) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is [17-[1-hydroxy-1-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-[1-hydroxy-1-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 4836173 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | [17-[1-hydroxy-1-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C3CCC2C(C)(O)C2CC(C)=NO2)C1 |
| InChI | InChI=1S/C27H41NO4/c1-16-14-24(32-28-16)27(5,30)23-9-8-21-20-7-6-18-15-19(31-17(2)29)10-12-25(18,3)22(20)11-13-26(21,23)4/h6,19-24,30H,7-15H2,1-5H3 |
| InChIKey | PSFSJGCZBKEQJW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|