C19H27NO2 — CID 66708143
(8R,9R,10R,13S,14S)-3-amino-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthrene-7,17-diol (PubChem CID 66708143) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-3-amino-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthrene-7,17-diol.
| Compound Name | (8R,9R,10R,13S,14S)-3-amino-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthrene-7,17-diol |
|---|---|
| PubChem CID | 66708143 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (8R,9R,10R,13S,14S)-3-amino-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthrene-7,17-diol |
| SMILES | C[C@]12C=CC(N)CC1=CC(O)[C@@H]1[C@H]2CC[C@]2(C)C(O)=CC[C@@H]12 |
| InChI | InChI=1S/C19H27NO2/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h4-5,7,10,12-15,17,21-22H,3,6,8-9,20H2,1-2H3/t12?,13-,14+,15?,17-,18-,19-/m0/s1 |
| InChIKey | GPEVZDHRECDUDG-YDYOXOKUSA-N |
| XLogP | 3.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|