C19H29NO2 — CID 66708019
(5R,7S,8R,9S,10S,13S,14S)-3-amino-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-7,17-diol (PubChem CID 66708019) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (5R,7S,8R,9S,10S,13S,14S)-3-amino-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-7,17-diol.
| Compound Name | (5R,7S,8R,9S,10S,13S,14S)-3-amino-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-7,17-diol |
|---|---|
| PubChem CID | 66708019 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (5R,7S,8R,9S,10S,13S,14S)-3-amino-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-7,17-diol |
| SMILES | C[C@]12CCC(N)=C[C@H]1C[C@H](O)[C@@H]1[C@@H]2CC[C@]2(C)C(O)=CC[C@@H]12 |
| InChI | InChI=1S/C19H29NO2/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h4,9,11,13-15,17,21-22H,3,5-8,10,20H2,1-2H3/t11-,13-,14-,15-,17-,18-,19-/m0/s1 |
| InChIKey | HINFCJZCWLWCAH-QDVJHEOESA-N |
| XLogP | 3.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |