C19H28O3 — CID 66708183
(8R,9R,10R,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7,17-triol (PubChem CID 66708183) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7,17-triol.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7,17-triol |
|---|---|
| PubChem CID | 66708183 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7,17-triol |
| SMILES | C[C@]12CCC(O)=CC1CC(O)[C@@H]1[C@H]2CC[C@]2(C)C(O)=CC[C@@H]12 |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h4,9,11,13-15,17,20-22H,3,5-8,10H2,1-2H3/t11?,13-,14+,15?,17-,18-,19-/m0/s1 |
| InChIKey | IQSYWFJBOBMTGI-WGDAFDNRSA-N |
| XLogP | 4.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |