C19H27NO3 — CID 67024835
(3R,7R,8R,9S,10R,13S,14S,17R)-17-amino-3,7-dihydroxy-10,13-dimethyl-3,4,7,8,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one (PubChem CID 67024835) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (3R,7R,8R,9S,10R,13S,14S,17R)-17-amino-3,7-dihydroxy-10,13-dimethyl-3,4,7,8,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (3R,7R,8R,9S,10R,13S,14S,17R)-17-amino-3,7-dihydroxy-10,13-dimethyl-3,4,7,8,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 67024835 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3R,7R,8R,9S,10R,13S,14S,17R)-17-amino-3,7-dihydroxy-10,13-dimethyl-3,4,7,8,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one |
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@@H](O)C=C4C[C@@H](O)C=C[C@@]43C)[C@@H]1CC(=O)[C@@H]2N |
| InChI | InChI=1S/C19H27NO3/c1-18-5-3-11(21)7-10(18)8-14(22)16-12(18)4-6-19(2)13(16)9-15(23)17(19)20/h3,5,8,11-14,16-17,21-22H,4,6-7,9,20H2,1-2H3/t11-,12-,13-,14-,16+,17-,18-,19-/m0/s1 |
| InChIKey | UODAFEHGGSCLFT-FYUHNPBOSA-N |
| XLogP | 1.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|