C20H27BrO4 — CID 157085390
[(3R,10R,13S,16R,17R)-16-bromo-3,7-dihydroxy-10-methyl-3,4,7,8,9,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 157085390) has the molecular formula C20H27BrO4 and a molecular weight of 411.34 g/mol. Its IUPAC name is [(3R,10R,13S,16R,17R)-16-bromo-3,7-dihydroxy-10-methyl-3,4,7,8,9,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3R,10R,13S,16R,17R)-16-bromo-3,7-dihydroxy-10-methyl-3,4,7,8,9,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 157085390 |
| Molecular Formula | C20H27BrO4 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [(3R,10R,13S,16R,17R)-16-bromo-3,7-dihydroxy-10-methyl-3,4,7,8,9,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](Br)CC2C3C(O)C=C4C[C@@H](O)C=C[C@]4(C)C3CC[C@@H]21 |
| InChI | InChI=1S/C20H27BrO4/c1-10(22)25-19-13-3-4-15-18(14(13)9-16(19)21)17(24)8-11-7-12(23)5-6-20(11,15)2/h5-6,8,12-19,23-24H,3-4,7,9H2,1-2H3/t12-,13-,14?,15?,16+,17?,18?,19+,20-/m0/s1 |
| InChIKey | GVELKMQDMYCEQC-DGTNHMIBSA-N |
| XLogP | 2.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|