C21H28O3 — CID 11529982
[(8R,9S,10R,13S,14S)-17-hydroxy-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 11529982) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S)-17-hydroxy-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S)-17-hydroxy-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11529982 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | [(8R,9S,10R,13S,14S)-17-hydroxy-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1C=C[C@@]2(C)C(=C1)C=C[C@@H]1[C@@H]2CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C21H28O3/c1-13(22)24-15-8-10-20(2)14(12-15)4-5-16-17-6-7-19(23)21(17,3)11-9-18(16)20/h4-5,8,10,12,15-19,23H,6-7,9,11H2,1-3H3/t15?,16-,17-,18-,19?,20-,21-/m0/s1 |
| InChIKey | GLADHHYBUQERTH-VVCMQVJSSA-N |
| XLogP | 3.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|