C19H26N2O — CID 91316974
(10R,13S,17S)-3-diazenyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-ol (PubChem CID 91316974) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is (10R,13S,17S)-3-diazenyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (10R,13S,17S)-3-diazenyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 91316974 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (10R,13S,17S)-3-diazenyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-ol |
| SMILES | [H]/N=N/C1C=C[C@@]2(C)C(=C1)C=CC1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C19H26N2O/c1-18-9-7-13(21-20)11-12(18)3-4-14-15-5-6-17(22)19(15,2)10-8-16(14)18/h3-4,7,9,11,13-17,20,22H,5-6,8,10H2,1-2H3/b21-20+/t13?,14?,15?,16?,17-,18-,19-/m0/s1 |
| InChIKey | WHQGKDZOWUVMHQ-ABPOPSFESA-N |
| XLogP | 4.26 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|