C20H28 — CID 11492722
(8S,9S,10R,13R,14S,17R)-10,13,17-trimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthrene (PubChem CID 11492722) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-10,13,17-trimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13R,14S,17R)-10,13,17-trimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 11492722 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-10,13,17-trimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]3C=CC4=CCC=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H28/c1-14-7-10-17-16-9-8-15-6-4-5-12-20(15,3)18(16)11-13-19(14,17)2/h5-6,8-9,12,14,16-18H,4,7,10-11,13H2,1-3H3/t14-,16+,17+,18+,19-,20+/m1/s1 |
| InChIKey | FZILARREKIKNEL-HRKNKHRHSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|