C19H27NO — CID 66708618
(3S,8R,9S,10R,13S,14S,17S)-17-amino-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-3-ol (PubChem CID 66708618) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17S)-17-amino-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17S)-17-amino-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 66708618 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-17-amino-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](C=CC4=C[C@@H](O)C=C[C@@]43C)[C@@H]1CC[C@@H]2N |
| InChI | InChI=1S/C19H27NO/c1-18-9-7-13(21)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h3-4,7,9,11,13-17,21H,5-6,8,10,20H2,1-2H3/t13-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | FHHILSBOWMYXTM-LOVVWNRFSA-N |
| XLogP | 3.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|