C23H36 — CID 145295115
ethane;10,13,17-trimethyl-3-methylidene-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 145295115) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is ethane;10,13,17-trimethyl-3-methylidene-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | ethane;10,13,17-trimethyl-3-methylidene-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 145295115 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | ethane;10,13,17-trimethyl-3-methylidene-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1C=C2C=CC3C(CCC4(C)C(C)CCC34)C2(C)CC1.CC |
| InChI | InChI=1S/C21H30.C2H6/c1-14-9-11-21(4)16(13-14)6-7-17-18-8-5-15(2)20(18,3)12-10-19(17)21;1-2/h6-7,13,15,17-19H,1,5,8-12H2,2-4H3;1-2H3 |
| InChIKey | HAVFPGKIGSOLPB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |