C21H32OSi — CID 123198952
[(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]oxysilane (PubChem CID 123198952) has the molecular formula C21H32OSi and a molecular weight of 328.57 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]oxysilane.
| Compound Name | [(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]oxysilane |
|---|---|
| PubChem CID | 123198952 |
| Molecular Formula | C21H32OSi |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]oxysilane |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(O[SiH3])=CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H32OSi/c1-4-14-6-8-18-17-7-5-15-13-16(22-23)9-11-21(15,3)19(17)10-12-20(14,18)2/h5,7,9,13-14,17-19H,4,6,8,10-12H2,1-3,23H3/t14-,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | YSELUERKXBYQOQ-NWSAAYAGSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|