C21H31F — CID 163515101
(8S,9S,10R,13R,14S,17S)-17-ethyl-6-fluoro-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 163515101) has the molecular formula C21H31F and a molecular weight of 302.48 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17S)-17-ethyl-6-fluoro-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-6-fluoro-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 163515101 |
| Molecular Formula | C21H31F |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-6-fluoro-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3C=C(F)C4=CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31F/c1-4-14-8-9-16-15-13-19(22)18-7-5-6-11-21(18,3)17(15)10-12-20(14,16)2/h7,13-17H,4-6,8-12H2,1-3H3/t14-,15-,16-,17-,20+,21+/m0/s1 |
| InChIKey | DGAAGMXDUVMZHQ-OPLYSGQSSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |