C21H31Cl — CID 70612295
(8S,9S,10R,13R,14S,17S)-1-chloro-17-ethyl-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene (PubChem CID 70612295) has the molecular formula C21H31Cl and a molecular weight of 318.93 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17S)-1-chloro-17-ethyl-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13R,14S,17S)-1-chloro-17-ethyl-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 70612295 |
| Molecular Formula | C21H31Cl |
| Molecular Weight | 318.93 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (8S,9S,10R,13R,14S,17S)-1-chloro-17-ethyl-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC=C4CCC=C(Cl)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31Cl/c1-4-14-9-11-17-16-10-8-15-6-5-7-19(22)21(15,3)18(16)12-13-20(14,17)2/h7-8,14,16-18H,4-6,9-13H2,1-3H3/t14-,16-,17-,18-,20+,21-/m0/s1 |
| InChIKey | QYEXWSYDQQBYBE-BUBWIEDMSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.93 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|