C23H37NO — CID 87550325
(3S,8S,9S,10R,13R,14S,17S)-3-(aziridin-1-yl)-17-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 87550325) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17S)-3-(aziridin-1-yl)-17-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17S)-3-(aziridin-1-yl)-17-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 87550325 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17S)-3-(aziridin-1-yl)-17-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@](O)(N5CC5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H37NO/c1-4-16-6-8-19-18-7-5-17-15-23(25,24-13-14-24)12-11-22(17,3)20(18)9-10-21(16,19)2/h5,16,18-20,25H,4,6-15H2,1-3H3/t16-,18-,19-,20-,21+,22-,23-/m0/s1 |
| InChIKey | GGRLYQOPJMTEBJ-LBRICPRVSA-N |
| XLogP | 4.98 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|