C24H39ClO — CID 154368669
(3S,8S,9S,10R,13R,14S,17S)-3-(3-chloropropoxy)-17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 154368669) has the molecular formula C24H39ClO and a molecular weight of 379.03 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17S)-3-(3-chloropropoxy)-17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8S,9S,10R,13R,14S,17S)-3-(3-chloropropoxy)-17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154368669 |
| Molecular Formula | C24H39ClO |
| Molecular Weight | 379.03 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17S)-3-(3-chloropropoxy)-17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OCCCCl)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H39ClO/c1-4-17-7-9-21-20-8-6-18-16-19(26-15-5-14-25)10-12-24(18,3)22(20)11-13-23(17,21)2/h6,17,19-22H,4-5,7-16H2,1-3H3/t17-,19-,20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | WPYCFQBLHFNYCP-PQURANIKSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.03 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|