C21H31ClO — CID 70563231
(8S,9S,10R,13R,14S,17S)-2-chloro-17-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70563231) has the molecular formula C21H31ClO and a molecular weight of 334.93 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17S)-2-chloro-17-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13R,14S,17S)-2-chloro-17-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70563231 |
| Molecular Formula | C21H31ClO |
| Molecular Weight | 334.93 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (8S,9S,10R,13R,14S,17S)-2-chloro-17-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC=C4CC(=O)C(Cl)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31ClO/c1-4-13-6-8-16-15-7-5-14-11-19(23)18(22)12-21(14,3)17(15)9-10-20(13,16)2/h5,13,15-18H,4,6-12H2,1-3H3/t13-,15-,16-,17-,18?,20+,21-/m0/s1 |
| InChIKey | IELXZTBSUSYASQ-SZHVWDHSSA-N |
| XLogP | 5.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.93 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|