C26H44O — CID 142333021
ethane;4-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanal (PubChem CID 142333021) has the molecular formula C26H44O and a molecular weight of 372.64 g/mol. Its IUPAC name is ethane;4-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanal.
| Compound Name | ethane;4-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanal |
|---|---|
| PubChem CID | 142333021 |
| Molecular Formula | C26H44O |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | ethane;4-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanal |
| SMILES | CC.CC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCC=O)CCC32)C1 |
| InChI | InChI=1S/C24H38O.C2H6/c1-17-11-13-24(3)19(16-17)7-9-20-21-10-8-18(6-4-5-15-25)23(21,2)14-12-22(20)24;1-2/h7,15,17-18,20-22H,4-6,8-14,16H2,1-3H3;1-2H3 |
| InChIKey | JUMDWKBCVNCQIJ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|